C18H29N3O5S — CID 110633583
tert-butyl N-[1-[[3-(dimethylsulfamoyl)benzoyl]-methylamino]propan-2-yl]carbamate (PubChem CID 110633583) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-(dimethylsulfamoyl)benzoyl]-methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-(dimethylsulfamoyl)benzoyl]-methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 110633583 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | tert-butyl N-[1-[[3-(dimethylsulfamoyl)benzoyl]-methylamino]propan-2-yl]carbamate |
| SMILES | CC(CN(C)C(=O)c1cccc(S(=O)(=O)N(C)C)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N3O5S/c1-13(19-17(23)26-18(2,3)4)12-21(7)16(22)14-9-8-10-15(11-14)27(24,25)20(5)6/h8-11,13H,12H2,1-7H3,(H,19,23) |
| InChIKey | MNNTZNIUKHKYSM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |