C16H24ClN3O3 — CID 110315268
tert-butyl N-[(2S)-1-[(3-chlorophenyl)carbamoyl-methylamino]propan-2-yl]carbamate (PubChem CID 110315268) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(3-chlorophenyl)carbamoyl-methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(3-chlorophenyl)carbamoyl-methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 110315268 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(3-chlorophenyl)carbamoyl-methylamino]propan-2-yl]carbamate |
| SMILES | C[C@@H](CN(C)C(=O)Nc1cccc(Cl)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24ClN3O3/c1-11(18-15(22)23-16(2,3)4)10-20(5)14(21)19-13-8-6-7-12(17)9-13/h6-9,11H,10H2,1-5H3,(H,18,22)(H,19,21)/t11-/m0/s1 |
| InChIKey | KKLSRXBSTXQPRO-NSHDSACASA-N |
| XLogP | 3.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |