C19H28ClN3O3 — CID 55841892
tert-butyl N-[1-[1-(3-chloroanilino)-1-oxopropan-2-yl]piperidin-4-yl]carbamate (PubChem CID 55841892) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(3-chloroanilino)-1-oxopropan-2-yl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(3-chloroanilino)-1-oxopropan-2-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55841892 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | tert-butyl N-[1-[1-(3-chloroanilino)-1-oxopropan-2-yl]piperidin-4-yl]carbamate |
| SMILES | CC(C(=O)Nc1cccc(Cl)c1)N1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H28ClN3O3/c1-13(17(24)21-16-7-5-6-14(20)12-16)23-10-8-15(9-11-23)22-18(25)26-19(2,3)4/h5-7,12-13,15H,8-11H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | GGFYWBOZRSIVCI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |