C20H32N2O3 — CID 110315248
tert-butyl N-[(2S)-1-[(4-tert-butylbenzoyl)-methylamino]propan-2-yl]carbamate (PubChem CID 110315248) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(4-tert-butylbenzoyl)-methylamino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(4-tert-butylbenzoyl)-methylamino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 110315248 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(4-tert-butylbenzoyl)-methylamino]propan-2-yl]carbamate |
| SMILES | C[C@@H](CN(C)C(=O)c1ccc(C(C)(C)C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O3/c1-14(21-18(24)25-20(5,6)7)13-22(8)17(23)15-9-11-16(12-10-15)19(2,3)4/h9-12,14H,13H2,1-8H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | UEDYDYYSNJEKKK-AWEZNQCLSA-N |
| XLogP | 3.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |