C18H26N4O3 — CID 95327057
tert-butyl N-[[3-[[[(2S)-2-cyanopropyl]-methylcarbamoyl]amino]phenyl]methyl]carbamate (PubChem CID 95327057) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl N-[[3-[[[(2S)-2-cyanopropyl]-methylcarbamoyl]amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[[[(2S)-2-cyanopropyl]-methylcarbamoyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 95327057 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | tert-butyl N-[[3-[[[(2S)-2-cyanopropyl]-methylcarbamoyl]amino]phenyl]methyl]carbamate |
| SMILES | C[C@H](C#N)CN(C)C(=O)Nc1cccc(CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H26N4O3/c1-13(10-19)12-22(5)16(23)21-15-8-6-7-14(9-15)11-20-17(24)25-18(2,3)4/h6-9,13H,11-12H2,1-5H3,(H,20,24)(H,21,23)/t13-/m1/s1 |
| InChIKey | PZCPFCQOTPLOBE-CYBMUJFWSA-N |
| XLogP | 3.33 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |