C15H25N5O2 — CID 144847747
tert-butyl N-[2-(2,5-diamino-4-methanimidoyl-N-methylanilino)ethyl]carbamate (PubChem CID 144847747) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is tert-butyl N-[2-(2,5-diamino-4-methanimidoyl-N-methylanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,5-diamino-4-methanimidoyl-N-methylanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 144847747 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | tert-butyl N-[2-(2,5-diamino-4-methanimidoyl-N-methylanilino)ethyl]carbamate |
| SMILES | [H]/N=C/c1cc(N)c(N(C)CCNC(=O)OC(C)(C)C)cc1N |
| InChI | InChI=1S/C15H25N5O2/c1-15(2,3)22-14(21)19-5-6-20(4)13-8-11(17)10(9-16)7-12(13)18/h7-9,16H,5-6,17-18H2,1-4H3,(H,19,21)/b16-9+ |
| InChIKey | QYVWHEUTDXHDFN-CXUHLZMHSA-N |
| XLogP | 1.81 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|