C14H20N4O2 — CID 121426940
tert-butyl N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]carbamate (PubChem CID 121426940) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 121426940 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | tert-butyl N-[2-[(4-cyano-2-pyridinyl)-methylamino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)OC(C)(C)C)c1cc(C#N)ccn1 |
| InChI | InChI=1S/C14H20N4O2/c1-14(2,3)20-13(19)17-7-8-18(4)12-9-11(10-15)5-6-16-12/h5-6,9H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | ZAUKBZWTAPQKHL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |