C17H22FN5O2 — CID 114080800
tert-butyl N-[2-[[4-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-methylamino]ethyl]carbamate (PubChem CID 114080800) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 114080800 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-[2-[[4-(5-fluoro-3-pyridinyl)pyrimidin-2-yl]-methylamino]ethyl]carbamate |
| SMILES | CN(CCNC(=O)OC(C)(C)C)c1nccc(-c2cncc(F)c2)n1 |
| InChI | InChI=1S/C17H22FN5O2/c1-17(2,3)25-16(24)21-7-8-23(4)15-20-6-5-14(22-15)12-9-13(18)11-19-10-12/h5-6,9-11H,7-8H2,1-4H3,(H,21,24) |
| InChIKey | JXMTYAVYVRVKAH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |