C21H33N7O2 — CID 169170123
tert-butyl N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methylamino]propyl]carbamate;ethene (PubChem CID 169170123) has the molecular formula C21H33N7O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methylamino]propyl]carbamate;ethene.
| Compound Name | tert-butyl N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methylamino]propyl]carbamate;ethene |
|---|---|
| PubChem CID | 169170123 |
| Molecular Formula | C21H33N7O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | tert-butyl N-[3-[[4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methylamino]propyl]carbamate;ethene |
| SMILES | C=C.CN(CCCNC(=O)OC(C)(C)C)c1nccc(Nc2cc(C3CC3)[nH]n2)n1 |
| InChI | InChI=1S/C19H29N7O2.C2H4/c1-19(2,3)28-18(27)21-9-5-11-26(4)17-20-10-8-15(23-17)22-16-12-14(24-25-16)13-6-7-13;1-2/h8,10,12-13H,5-7,9,11H2,1-4H3,(H,21,27)(H2,20,22,23,24,25);1-2H2 |
| InChIKey | AYQBHBKYEIODHV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|