C13H21FN4O2 — CID 75482555
tert-butyl N-[3-[(5-fluoropyrimidin-2-yl)-methylamino]propyl]carbamate (PubChem CID 75482555) has the molecular formula C13H21FN4O2 and a molecular weight of 284.33 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-fluoropyrimidin-2-yl)-methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-fluoropyrimidin-2-yl)-methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 75482555 |
| Molecular Formula | C13H21FN4O2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | tert-butyl N-[3-[(5-fluoropyrimidin-2-yl)-methylamino]propyl]carbamate |
| SMILES | CN(CCCNC(=O)OC(C)(C)C)c1ncc(F)cn1 |
| InChI | InChI=1S/C13H21FN4O2/c1-13(2,3)20-12(19)15-6-5-7-18(4)11-16-8-10(14)9-17-11/h8-9H,5-7H2,1-4H3,(H,15,19) |
| InChIKey | HJAKLKRRAJANQR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|