C15H26N4O3 — CID 103279355
tert-butyl N-[2-[[5-(methoxymethyl)-4-methylpyrimidin-2-yl]-methylamino]ethyl]carbamate (PubChem CID 103279355) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(methoxymethyl)-4-methylpyrimidin-2-yl]-methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(methoxymethyl)-4-methylpyrimidin-2-yl]-methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 103279355 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | tert-butyl N-[2-[[5-(methoxymethyl)-4-methylpyrimidin-2-yl]-methylamino]ethyl]carbamate |
| SMILES | COCc1cnc(N(C)CCNC(=O)OC(C)(C)C)nc1C |
| InChI | InChI=1S/C15H26N4O3/c1-11-12(10-21-6)9-17-13(18-11)19(5)8-7-16-14(20)22-15(2,3)4/h9H,7-8,10H2,1-6H3,(H,16,20) |
| InChIKey | ZXZMPTPCHCHUJV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |