C11H22N4O3S — CID 91561171
tert-butyl N-[2-[dimethylaminomethylidenecarbamoyl(sulfanyl)amino]ethyl]carbamate (PubChem CID 91561171) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is tert-butyl N-[2-[dimethylaminomethylidenecarbamoyl(sulfanyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[dimethylaminomethylidenecarbamoyl(sulfanyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 91561171 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | tert-butyl N-[2-[dimethylaminomethylidenecarbamoyl(sulfanyl)amino]ethyl]carbamate |
| SMILES | CN(C)C=NC(=O)N(S)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N4O3S/c1-11(2,3)18-10(17)12-6-7-15(19)9(16)13-8-14(4)5/h8,19H,6-7H2,1-5H3,(H,12,17) |
| InChIKey | GZBZYCXFQPLLAW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|