C12H18FN3O2 — CID 167721913
tert-butyl N-[2-(5-fluoropyrimidin-2-yl)propan-2-yl]carbamate (PubChem CID 167721913) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is tert-butyl N-[2-(5-fluoropyrimidin-2-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(5-fluoropyrimidin-2-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 167721913 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | tert-butyl N-[2-(5-fluoropyrimidin-2-yl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C1=NC=C(C=N1)F |
| InChI | InChI=1S/C12H18FN3O2/c1-11(2,3)18-10(17)16-12(4,5)9-14-6-8(13)7-15-9/h6-7H,1-5H3,(H,16,17) |
| InChIKey | XEBQSVMVUQFSAD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 294 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |