C14H20F2N4O3 — CID 68714361
tert-butyl N-[1-[2-(3,5-difluoro-2-pyridinyl)hydrazinyl]-2-methyl-1-oxopropan-2-yl]carbamate (PubChem CID 68714361) has the molecular formula C14H20F2N4O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(3,5-difluoro-2-pyridinyl)hydrazinyl]-2-methyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(3,5-difluoro-2-pyridinyl)hydrazinyl]-2-methyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 68714361 |
| Molecular Formula | C14H20F2N4O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | tert-butyl N-[1-[2-(3,5-difluoro-2-pyridinyl)hydrazinyl]-2-methyl-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)NNc1ncc(F)cc1F |
| InChI | InChI=1S/C14H20F2N4O3/c1-13(2,3)23-12(22)18-14(4,5)11(21)20-19-10-9(16)6-8(15)7-17-10/h6-7H,1-5H3,(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | BQRITMSCUZCIQX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|