C11H12F4N2O2 — CID 155894591
tert-butyl N-[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 155894591) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is tert-butyl N-[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 155894591 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | tert-butyl N-[5-fluoro-6-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H12F4N2O2/c1-10(2,3)19-9(18)17-6-4-7(12)8(16-5-6)11(13,14)15/h4-5H,1-3H3,(H,17,18) |
| InChIKey | COERSVKOVIMAMR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |