C14H20ClF3N2O2 — CID 156715413
tert-butyl N-[5-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane (PubChem CID 156715413) has the molecular formula C14H20ClF3N2O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is tert-butyl N-[5-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[5-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 156715413 |
| Molecular Formula | C14H20ClF3N2O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | tert-butyl N-[5-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane |
| SMILES | CC.Cc1c(NC(=O)OC(C)(C)C)cnc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C12H14ClF3N2O2.C2H6/c1-6-7(18-10(19)20-11(2,3)4)5-17-9(8(6)13)12(14,15)16;1-2/h5H,1-4H3,(H,18,19);1-2H3 |
| InChIKey | XSWIIRZQUKIJRV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |