C14H23BrN2O2 — CID 142447480
tert-butyl N-(5-bromo-4,6-dimethyl-3-pyridinyl)carbamate;ethane (PubChem CID 142447480) has the molecular formula C14H23BrN2O2 and a molecular weight of 331.25 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-4,6-dimethyl-3-pyridinyl)carbamate;ethane.
| Compound Name | tert-butyl N-(5-bromo-4,6-dimethyl-3-pyridinyl)carbamate;ethane |
|---|---|
| PubChem CID | 142447480 |
| Molecular Formula | C14H23BrN2O2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | tert-butyl N-(5-bromo-4,6-dimethyl-3-pyridinyl)carbamate;ethane |
| SMILES | CC.Cc1ncc(NC(=O)OC(C)(C)C)c(C)c1Br |
| InChI | InChI=1S/C12H17BrN2O2.C2H6/c1-7-9(6-14-8(2)10(7)13)15-11(16)17-12(3,4)5;1-2/h6H,1-5H3,(H,15,16);1-2H3 |
| InChIKey | HTKGIBFVLLBSQX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |