C11H17N3O2 — CID 133060985
tert-butyl N-(5-amino-4-methyl-3-pyridinyl)carbamate (PubChem CID 133060985) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is tert-butyl N-(5-amino-4-methyl-3-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(5-amino-4-methyl-3-pyridinyl)carbamate |
|---|---|
| PubChem CID | 133060985 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | tert-butyl N-(5-amino-4-methyl-3-pyridinyl)carbamate |
| SMILES | Cc1c(N)cncc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17N3O2/c1-7-8(12)5-13-6-9(7)14-10(15)16-11(2,3)4/h5-6H,12H2,1-4H3,(H,14,15) |
| InChIKey | VQJPQTLUMVIWKO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |