C12H17ClN2O2 — CID 69489430
tert-butyl N-(2-amino-5-chloro-4-methylphenyl)carbamate (PubChem CID 69489430) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is tert-butyl N-(2-amino-5-chloro-4-methylphenyl)carbamate.
| Compound Name | tert-butyl N-(2-amino-5-chloro-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 69489430 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | tert-butyl N-(2-amino-5-chloro-4-methylphenyl)carbamate |
| SMILES | Cc1cc(N)c(NC(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O2/c1-7-5-9(14)10(6-8(7)13)15-11(16)17-12(2,3)4/h5-6H,14H2,1-4H3,(H,15,16) |
| InChIKey | MLHCDZJYGMFMKX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|