C15H23F3N2O3 — CID 156715354
tert-butyl N-[5-methoxy-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane (PubChem CID 156715354) has the molecular formula C15H23F3N2O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[5-methoxy-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 156715354 |
| Molecular Formula | C15H23F3N2O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-methyl-6-(trifluoromethyl)-3-pyridinyl]carbamate;ethane |
| SMILES | CC.COc1c(C(F)(F)F)ncc(NC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C13H17F3N2O3.C2H6/c1-7-8(18-11(19)21-12(2,3)4)6-17-10(9(7)20-5)13(14,15)16;1-2/h6H,1-5H3,(H,18,19);1-2H3 |
| InChIKey | VEKOXTOFGBEYKO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |