C11H17N3O3 — CID 141287875
tert-butyl N-(3-methoxy-5-methylpyrazin-2-yl)carbamate (PubChem CID 141287875) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is tert-butyl N-(3-methoxy-5-methylpyrazin-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-methoxy-5-methylpyrazin-2-yl)carbamate |
|---|---|
| PubChem CID | 141287875 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | tert-butyl N-(3-methoxy-5-methylpyrazin-2-yl)carbamate |
| SMILES | COc1nc(C)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17N3O3/c1-7-6-12-8(9(13-7)16-5)14-10(15)17-11(2,3)4/h6H,1-5H3,(H,12,14,15) |
| InChIKey | CGUWCSHIKZMSBB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |