C14H17N5O2 — CID 138494591
tert-butyl N-(3-methyl-5-pyrimidin-5-ylpyrazin-2-yl)carbamate (PubChem CID 138494591) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is tert-butyl N-(3-methyl-5-pyrimidin-5-ylpyrazin-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-methyl-5-pyrimidin-5-ylpyrazin-2-yl)carbamate |
|---|---|
| PubChem CID | 138494591 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | tert-butyl N-(3-methyl-5-pyrimidin-5-ylpyrazin-2-yl)carbamate |
| SMILES | Cc1nc(-c2cncnc2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H17N5O2/c1-9-12(19-13(20)21-14(2,3)4)17-7-11(18-9)10-5-15-8-16-6-10/h5-8H,1-4H3,(H,17,19,20) |
| InChIKey | PNGHNTSOQPFTJC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |