C11H17BN2O5 — CID 123134912
[5-methoxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid (PubChem CID 123134912) has the molecular formula C11H17BN2O5 and a molecular weight of 268.08 g/mol. Its IUPAC name is [5-methoxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid.
| Compound Name | [5-methoxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 123134912 |
| Molecular Formula | C11H17BN2O5 |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [5-methoxy-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid |
| SMILES | COc1cc(B(O)O)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17BN2O5/c1-11(2,3)19-10(15)14-9-8(18-4)5-7(6-13-9)12(16)17/h5-6,16-17H,1-4H3,(H,13,14,15) |
| InChIKey | ZXZLOBAYJCVUIA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|