C17H27N3O3 — CID 118957680
tert-butyl N-[5-[[[(1S)-1-cyclopropylethyl]amino]methyl]-3-methoxy-2-pyridinyl]carbamate (PubChem CID 118957680) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl N-[5-[[[(1S)-1-cyclopropylethyl]amino]methyl]-3-methoxy-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[[[(1S)-1-cyclopropylethyl]amino]methyl]-3-methoxy-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118957680 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl N-[5-[[[(1S)-1-cyclopropylethyl]amino]methyl]-3-methoxy-2-pyridinyl]carbamate |
| SMILES | COc1cc(CN[C@@H](C)C2CC2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-11(13-6-7-13)18-9-12-8-14(22-5)15(19-10-12)20-16(21)23-17(2,3)4/h8,10-11,13,18H,6-7,9H2,1-5H3,(H,19,20,21)/t11-/m0/s1 |
| InChIKey | UZILQGJVYFEFIL-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |