C15H23NO4 — CID 117451587
tert-butyl N-[4-(3-hydroxypropyl)-2-methoxyphenyl]carbamate (PubChem CID 117451587) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is tert-butyl N-[4-(3-hydroxypropyl)-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[4-(3-hydroxypropyl)-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 117451587 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl N-[4-(3-hydroxypropyl)-2-methoxyphenyl]carbamate |
| SMILES | COc1cc(CCCO)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO4/c1-15(2,3)20-14(18)16-12-8-7-11(6-5-9-17)10-13(12)19-4/h7-8,10,17H,5-6,9H2,1-4H3,(H,16,18) |
| InChIKey | BHEBKOCDVHVTSU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |