C15H24N2O4 — CID 117477647
tert-butyl N-[4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenyl]carbamate (PubChem CID 117477647) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl N-[4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 117477647 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | tert-butyl N-[4-[1-hydroxy-2-(methylamino)ethyl]-2-methoxyphenyl]carbamate |
| SMILES | CNCC(O)c1ccc(NC(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-15(2,3)21-14(19)17-11-7-6-10(8-13(11)20-5)12(18)9-16-4/h6-8,12,16,18H,9H2,1-5H3,(H,17,19) |
| InChIKey | TYZMATZROMQDFO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |