C13H19N3O4 — CID 178125649
tert-butyl N-[4-methoxy-6-(methylcarbamoyl)-3-pyridinyl]carbamate (PubChem CID 178125649) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is tert-butyl N-[4-methoxy-6-(methylcarbamoyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-methoxy-6-(methylcarbamoyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 178125649 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | tert-butyl N-[4-methoxy-6-(methylcarbamoyl)-3-pyridinyl]carbamate |
| SMILES | CNC(=O)c1cc(OC)c(NC(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C13H19N3O4/c1-13(2,3)20-12(18)16-9-7-15-8(11(17)14-4)6-10(9)19-5/h6-7H,1-5H3,(H,14,17)(H,16,18) |
| InChIKey | VVIMLSCNIVNLHU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |