C10H14BBrN2O4 — CID 86767368
[5-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid (PubChem CID 86767368) has the molecular formula C10H14BBrN2O4 and a molecular weight of 316.95 g/mol. Its IUPAC name is [5-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid.
| Compound Name | [5-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 86767368 |
| Molecular Formula | C10H14BBrN2O4 |
| Molecular Weight | 316.95 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | [5-bromo-6-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(B(O)O)cc1Br |
| InChI | InChI=1S/C10H14BBrN2O4/c1-10(2,3)18-9(15)14-8-7(12)4-6(5-13-8)11(16)17/h4-5,16-17H,1-3H3,(H,13,14,15) |
| InChIKey | BXQLLPZNZVUIEG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.95 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|