C14H16BrN3O2 — CID 164517252
tert-butyl N-(7-bromo-2-methylquinazolin-4-yl)carbamate (PubChem CID 164517252) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is tert-butyl N-(7-bromo-2-methylquinazolin-4-yl)carbamate.
| Compound Name | tert-butyl N-(7-bromo-2-methylquinazolin-4-yl)carbamate |
|---|---|
| PubChem CID | 164517252 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | tert-butyl N-(7-bromo-2-methylquinazolin-4-yl)carbamate |
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)c2ccc(Br)cc2n1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-8-16-11-7-9(15)5-6-10(11)12(17-8)18-13(19)20-14(2,3)4/h5-7H,1-4H3,(H,16,17,18,19) |
| InChIKey | RLYGYBSUZOBZGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |