C15H17BrN2O3 — CID 156572162
tert-butyl N-(5-bromo-2-methoxyquinolin-7-yl)carbamate (PubChem CID 156572162) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-2-methoxyquinolin-7-yl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-2-methoxyquinolin-7-yl)carbamate |
|---|---|
| PubChem CID | 156572162 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | tert-butyl N-(5-bromo-2-methoxyquinolin-7-yl)carbamate |
| SMILES | COc1ccc2c(Br)cc(NC(=O)OC(C)(C)C)cc2n1 |
| InChI | InChI=1S/C15H17BrN2O3/c1-15(2,3)21-14(19)17-9-7-11(16)10-5-6-13(20-4)18-12(10)8-9/h5-8H,1-4H3,(H,17,19) |
| InChIKey | JOXHYQUFEHADMK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |