C15H19BrN2O2 — CID 59051841
tert-butyl N-(7-bromo-2,3-dimethyl-1H-indol-5-yl)carbamate (PubChem CID 59051841) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is tert-butyl N-(7-bromo-2,3-dimethyl-1H-indol-5-yl)carbamate.
| Compound Name | tert-butyl N-(7-bromo-2,3-dimethyl-1H-indol-5-yl)carbamate |
|---|---|
| PubChem CID | 59051841 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | tert-butyl N-(7-bromo-2,3-dimethyl-1H-indol-5-yl)carbamate |
| SMILES | Cc1[nH]c2c(Br)cc(NC(=O)OC(C)(C)C)cc2c1C |
| InChI | InChI=1S/C15H19BrN2O2/c1-8-9(2)17-13-11(8)6-10(7-12(13)16)18-14(19)20-15(3,4)5/h6-7,17H,1-5H3,(H,18,19) |
| InChIKey | HMUSNIYYVGHAPT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|