C14H21BrN2O4 — CID 177332343
tert-butyl N-[2-(bromomethyl)-6-(2-methoxyethoxy)-4-pyridinyl]carbamate (PubChem CID 177332343) has the molecular formula C14H21BrN2O4 and a molecular weight of 361.24 g/mol. Its IUPAC name is tert-butyl N-[2-(bromomethyl)-6-(2-methoxyethoxy)-4-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-(bromomethyl)-6-(2-methoxyethoxy)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 177332343 |
| Molecular Formula | C14H21BrN2O4 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | tert-butyl N-[2-(bromomethyl)-6-(2-methoxyethoxy)-4-pyridinyl]carbamate |
| SMILES | COCCOc1cc(NC(=O)OC(C)(C)C)cc(CBr)n1 |
| InChI | InChI=1S/C14H21BrN2O4/c1-14(2,3)21-13(18)17-10-7-11(9-15)16-12(8-10)20-6-5-19-4/h7-8H,5-6,9H2,1-4H3,(H,16,17,18) |
| InChIKey | RAXZABNXSSXMPE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|