C9H12BrN3O3 — CID 69088343
tert-butyl N-(5-bromo-2-oxo-1H-pyrimidin-6-yl)carbamate (PubChem CID 69088343) has the molecular formula C9H12BrN3O3 and a molecular weight of 290.12 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-2-oxo-1H-pyrimidin-6-yl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-2-oxo-1H-pyrimidin-6-yl)carbamate |
|---|---|
| PubChem CID | 69088343 |
| Molecular Formula | C9H12BrN3O3 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | tert-butyl N-(5-bromo-2-oxo-1H-pyrimidin-6-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1[nH]c(=O)ncc1Br |
| InChI | InChI=1S/C9H12BrN3O3/c1-9(2,3)16-8(15)13-6-5(10)4-11-7(14)12-6/h4H,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | HCCXLQWQFOUAQU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |