C11H15BrN4O2 — CID 143774918
tert-butyl N-(5-bromo-3-ethanimidoylpyrazin-2-yl)carbamate (PubChem CID 143774918) has the molecular formula C11H15BrN4O2 and a molecular weight of 315.17 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-3-ethanimidoylpyrazin-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-bromo-3-ethanimidoylpyrazin-2-yl)carbamate |
|---|---|
| PubChem CID | 143774918 |
| Molecular Formula | C11H15BrN4O2 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | tert-butyl N-(5-bromo-3-ethanimidoylpyrazin-2-yl)carbamate |
| SMILES | [H]/N=C(\C)c1nc(Br)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H15BrN4O2/c1-6(13)8-9(14-5-7(12)15-8)16-10(17)18-11(2,3)4/h5,13H,1-4H3,(H,14,16,17)/b13-6+ |
| InChIKey | XCVFWPXTEJRAEI-AWNIVKPZSA-N |
| XLogP | 2.97 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|