C12H12BrN3O4 — CID 162129001
tert-butyl N-(5-bromo-3-ethynylpyrazin-2-yl)oxycarbonylcarbamate (PubChem CID 162129001) has the molecular formula C12H12BrN3O4 and a molecular weight of 342.15 g/mol. Its IUPAC name is tert-butyl N-(5-bromo-3-ethynylpyrazin-2-yl)oxycarbonylcarbamate.
| Compound Name | tert-butyl N-(5-bromo-3-ethynylpyrazin-2-yl)oxycarbonylcarbamate |
|---|---|
| PubChem CID | 162129001 |
| Molecular Formula | C12H12BrN3O4 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | tert-butyl N-(5-bromo-3-ethynylpyrazin-2-yl)oxycarbonylcarbamate |
| SMILES | C#Cc1nc(Br)cnc1OC(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H12BrN3O4/c1-5-7-9(14-6-8(13)15-7)19-10(17)16-11(18)20-12(2,3)4/h1,6H,2-4H3,(H,16,17,18) |
| InChIKey | ZIKMURGSRILFJH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|