C12H15ClN2O4 — CID 170155819
tert-butyl N-(2-amino-6-chlorophenoxy)carbonylcarbamate (PubChem CID 170155819) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. Its IUPAC name is tert-butyl N-(2-amino-6-chlorophenoxy)carbonylcarbamate.
| Compound Name | tert-butyl N-(2-amino-6-chlorophenoxy)carbonylcarbamate |
|---|---|
| PubChem CID | 170155819 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | tert-butyl N-(2-amino-6-chlorophenoxy)carbonylcarbamate |
| SMILES | CC(C)(C)OC(=O)NC(=O)Oc1c(N)cccc1Cl |
| InChI | InChI=1S/C12H15ClN2O4/c1-12(2,3)19-11(17)15-10(16)18-9-7(13)5-4-6-8(9)14/h4-6H,14H2,1-3H3,(H,15,16,17) |
| InChIKey | IJIXEDWHSGXXHK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|