C15H21ClN2O2 — CID 170490150
tert-butyl N-[4-(2-amino-6-chlorophenyl)but-3-enyl]carbamate (PubChem CID 170490150) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is tert-butyl N-[4-(2-amino-6-chlorophenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-amino-6-chlorophenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490150 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | tert-butyl N-[4-(2-amino-6-chlorophenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1c(N)cccc1Cl |
| InChI | InChI=1S/C15H21ClN2O2/c1-15(2,3)20-14(19)18-10-5-4-7-11-12(16)8-6-9-13(11)17/h4,6-9H,5,10,17H2,1-3H3,(H,18,19) |
| InChIKey | PNHNTNJOMMMOPT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|