C14H14F3N5O2 — CID 138502896
tert-butyl N-[2-pyrimidin-5-yl-4-(trifluoromethyl)pyrimidin-5-yl]carbamate (PubChem CID 138502896) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is tert-butyl N-[2-pyrimidin-5-yl-4-(trifluoromethyl)pyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[2-pyrimidin-5-yl-4-(trifluoromethyl)pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 138502896 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | tert-butyl N-[2-pyrimidin-5-yl-4-(trifluoromethyl)pyrimidin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(-c2cncnc2)nc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3N5O2/c1-13(2,3)24-12(23)21-9-6-20-11(8-4-18-7-19-5-8)22-10(9)14(15,16)17/h4-7H,1-3H3,(H,21,23) |
| InChIKey | IVELMSSHLSJIDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |