C17H18N4O2 — CID 130471260
tert-butyl N-[6-(5-cyano-3-pyridinyl)-2-methyl-3-pyridinyl]carbamate (PubChem CID 130471260) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is tert-butyl N-[6-(5-cyano-3-pyridinyl)-2-methyl-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-(5-cyano-3-pyridinyl)-2-methyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 130471260 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl N-[6-(5-cyano-3-pyridinyl)-2-methyl-3-pyridinyl]carbamate |
| SMILES | Cc1nc(-c2cncc(C#N)c2)ccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H18N4O2/c1-11-14(21-16(22)23-17(2,3)4)5-6-15(20-11)13-7-12(8-18)9-19-10-13/h5-7,9-10H,1-4H3,(H,21,22) |
| InChIKey | ZOXOAIALYDCUMR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |