C16H21N3O4 — CID 123702114
ethyl 2-[2-cyano-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]acetate (PubChem CID 123702114) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethyl 2-[2-cyano-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-cyano-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 123702114 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | ethyl 2-[2-cyano-6-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(NC(=O)OC(C)(C)C)c(C)nc1C#N |
| InChI | InChI=1S/C16H21N3O4/c1-6-22-14(20)8-11-7-12(10(2)18-13(11)9-17)19-15(21)23-16(3,4)5/h7H,6,8H2,1-5H3,(H,19,21) |
| InChIKey | QHCBPAVUOZPBQZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |