C13H22N2O2Sn — CID 131735483
tert-butyl N-(5-trimethylstannyl-3-pyridinyl)carbamate (PubChem CID 131735483) has the molecular formula C13H22N2O2Sn and a molecular weight of 357.04 g/mol. Its IUPAC name is tert-butyl N-(5-trimethylstannyl-3-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(5-trimethylstannyl-3-pyridinyl)carbamate |
|---|---|
| PubChem CID | 131735483 |
| Molecular Formula | C13H22N2O2Sn |
| Molecular Weight | 357.04 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | tert-butyl N-(5-trimethylstannyl-3-pyridinyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cncc([Sn](C)(C)C)c1 |
| InChI | InChI=1S/C10H13N2O2.3CH3.Sn/c1-10(2,3)14-9(13)12-8-5-4-6-11-7-8;;;;/h5-7H,1-3H3,(H,12,13);3*1H3; |
| InChIKey | WHNUVPAWPZBMTI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.04 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |