C18H21N3O2 — CID 76675786
tert-butyl N-[5-[2-(3-aminophenyl)ethenyl]-3-pyridinyl]carbamate (PubChem CID 76675786) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is tert-butyl N-[5-[2-(3-aminophenyl)ethenyl]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-(3-aminophenyl)ethenyl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 76675786 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | tert-butyl N-[5-[2-(3-aminophenyl)ethenyl]-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cncc(C=Cc2cccc(N)c2)c1 |
| InChI | InChI=1S/C18H21N3O2/c1-18(2,3)23-17(22)21-16-10-14(11-20-12-16)8-7-13-5-4-6-15(19)9-13/h4-12H,19H2,1-3H3,(H,21,22) |
| InChIKey | FELVGUMXQMEUJZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|