C18H21N3O4 — CID 164753912
tert-butyl N-[5-(phenylmethoxycarbamoyl)-3-pyridinyl]carbamate (PubChem CID 164753912) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is tert-butyl N-[5-(phenylmethoxycarbamoyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-(phenylmethoxycarbamoyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164753912 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | tert-butyl N-[5-(phenylmethoxycarbamoyl)-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cncc(C(=O)NOCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-18(2,3)25-17(23)20-15-9-14(10-19-11-15)16(22)21-24-12-13-7-5-4-6-8-13/h4-11H,12H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | XOAPRKRTLICNTK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|