C15H21NO5 — CID 90910009
(4-hydroxyphenyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 90910009) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (4-hydroxyphenyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 90910009 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (4-hydroxyphenyl) 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C15H21NO5/c1-14(2,3)21-13(19)16-15(4,5)12(18)20-11-8-6-10(17)7-9-11/h6-9,17H,1-5H3,(H,16,19) |
| InChIKey | RZRUFGWJPVGMHV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|