C18H28N4O4 — CID 102069305
[4-[(diaminomethylideneamino)methyl]phenyl] (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 102069305) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is [4-[(diaminomethylideneamino)methyl]phenyl] (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [4-[(diaminomethylideneamino)methyl]phenyl] (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 102069305 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [4-[(diaminomethylideneamino)methyl]phenyl] (2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC[C@](C)(NC(=O)OC(C)(C)C)C(=O)Oc1ccc(CN=C(N)N)cc1 |
| InChI | InChI=1S/C18H28N4O4/c1-6-18(5,22-16(24)26-17(2,3)4)14(23)25-13-9-7-12(8-10-13)11-21-15(19)20/h7-10H,6,11H2,1-5H3,(H,22,24)(H4,19,20,21)/t18-/m0/s1 |
| InChIKey | CKPUMGYOQRYTGQ-SFHVURJKSA-N |
| XLogP | 2.06 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|