C18H28F3IN4O3 — CID 111757784
tert-butyl N-[2-methyl-1-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propan-2-yl]carbamate;hydroiodide (PubChem CID 111757784) has the molecular formula C18H28F3IN4O3 and a molecular weight of 532.35 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propan-2-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-methyl-1-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111757784 |
| Molecular Formula | C18H28F3IN4O3 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propan-2-yl]carbamate;hydroiodide |
| SMILES | CC(C)(CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C18H27F3N4O3.HI/c1-16(2,3)28-15(26)25-17(4,5)11-24-14(22)23-10-12-6-8-13(9-7-12)27-18(19,20)21;/h6-9H,10-11H2,1-5H3,(H,25,26)(H3,22,23,24);1H |
| InChIKey | QKSWSEIAIYUOLS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|