C15H22F3IN4O2 — CID 111597827
N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111597827) has the molecular formula C15H22F3IN4O2 and a molecular weight of 474.27 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111597827 |
| Molecular Formula | C15H22F3IN4O2 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CC(C)(C)NC(=O)CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1.I |
| InChI | InChI=1S/C15H21F3N4O2.HI/c1-14(2,3)22-12(23)9-21-13(19)20-8-10-4-6-11(7-5-10)24-15(16,17)18;/h4-7H,8-9H2,1-3H3,(H,22,23)(H3,19,20,21);1H |
| InChIKey | VEICNMNISVEQSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|