C15H21F3N4O2 — CID 111597828
N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111597828) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111597828 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-tert-butyl-2-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CC(C)(C)NC(=O)CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N4O2/c1-14(2,3)22-12(23)9-21-13(19)20-8-10-4-6-11(7-5-10)24-15(16,17)18/h4-7H,8-9H2,1-3H3,(H,22,23)(H3,19,20,21) |
| InChIKey | XMRBPEWOPUOTGN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|