C17H16F5N3O — CID 111599888
1-[2-(3,5-difluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111599888) has the molecular formula C17H16F5N3O and a molecular weight of 373.33 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111599888 |
| Molecular Formula | C17H16F5N3O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(OC(F)(F)F)cc1)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H16F5N3O/c18-13-7-12(8-14(19)9-13)5-6-24-16(23)25-10-11-1-3-15(4-2-11)26-17(20,21)22/h1-4,7-9H,5-6,10H2,(H3,23,24,25) |
| InChIKey | ZWNGZEGEBGPMAM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|