C15H23F3IN3O2S — CID 111811493
1-(2-tert-butylsulfinylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111811493) has the molecular formula C15H23F3IN3O2S and a molecular weight of 493.33 g/mol. Its IUPAC name is 1-(2-tert-butylsulfinylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfinylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111811493 |
| Molecular Formula | C15H23F3IN3O2S |
| Molecular Weight | 493.33 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 1-(2-tert-butylsulfinylethyl)-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CC(C)(C)S(=O)CCN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1.I |
| InChI | InChI=1S/C15H22F3N3O2S.HI/c1-14(2,3)24(22)9-8-20-13(19)21-10-11-4-6-12(7-5-11)23-15(16,17)18;/h4-7H,8-10H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | HUUPKFYSYDWQOE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|